C26H31NO2 — CID 59416819
methyl 3-methyl-1-spiro[cyclopentane-3,9'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-1-ylpyrrolidine-3-carboxylate (PubChem CID 59416819) has the molecular formula C26H31NO2 and a molecular weight of 389.54 g/mol. Its IUPAC name is methyl 3-methyl-1-spiro[cyclopentane-3,9'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-1-ylpyrrolidine-3-carboxylate.
| Compound Name | methyl 3-methyl-1-spiro[cyclopentane-3,9'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-1-ylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 59416819 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | methyl 3-methyl-1-spiro[cyclopentane-3,9'-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene]-1-ylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(C)CCN(C2CCC3(Cc4ccccc4Cc4ccccc43)C2)C1 |
| InChI | InChI=1S/C26H31NO2/c1-25(24(28)29-2)13-14-27(18-25)22-11-12-26(17-22)16-21-9-4-3-7-19(21)15-20-8-5-6-10-23(20)26/h3-10,22H,11-18H2,1-2H3 |
| InChIKey | BALILERJIKLTBA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |