C15H16O3 — CID 167092641
methyl 2'-oxospiro[1,2-dihydroindene-3,4'-cyclopentane]-1'-carboxylate (PubChem CID 167092641) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl 2'-oxospiro[1,2-dihydroindene-3,4'-cyclopentane]-1'-carboxylate.
| Compound Name | methyl 2'-oxospiro[1,2-dihydroindene-3,4'-cyclopentane]-1'-carboxylate |
|---|---|
| PubChem CID | 167092641 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl 2'-oxospiro[1,2-dihydroindene-3,4'-cyclopentane]-1'-carboxylate |
| SMILES | COC(=O)C1CC2(CCc3ccccc32)CC1=O |
| InChI | InChI=1S/C15H16O3/c1-18-14(17)11-8-15(9-13(11)16)7-6-10-4-2-3-5-12(10)15/h2-5,11H,6-9H2,1H3 |
| InChIKey | FSBGYGGOFBOIKX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|