C20H25NO3 — CID 88679352
2'-(4-ethoxyiminobutyl)spiro[1,2-dihydroindene-3,5'-cyclohexane]-1',3'-dione (PubChem CID 88679352) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2'-(4-ethoxyiminobutyl)spiro[1,2-dihydroindene-3,5'-cyclohexane]-1',3'-dione.
| Compound Name | 2'-(4-ethoxyiminobutyl)spiro[1,2-dihydroindene-3,5'-cyclohexane]-1',3'-dione |
|---|---|
| PubChem CID | 88679352 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2'-(4-ethoxyiminobutyl)spiro[1,2-dihydroindene-3,5'-cyclohexane]-1',3'-dione |
| SMILES | CCON=CCCCC1C(=O)CC2(CCc3ccccc32)CC1=O |
| InChI | InChI=1S/C20H25NO3/c1-2-24-21-12-6-5-8-16-18(22)13-20(14-19(16)23)11-10-15-7-3-4-9-17(15)20/h3-4,7,9,12,16H,2,5-6,8,10-11,13-14H2,1H3 |
| InChIKey | VACOOZMVGLNECW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|