C18H20N4O3 — CID 59417208
N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(azetidin-3-yl)buta-1,3-diynyl]benzamide (PubChem CID 59417208) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(azetidin-3-yl)buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(azetidin-3-yl)buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 59417208 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N-[(2S,3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-(azetidin-3-yl)buta-1,3-diynyl]benzamide |
| SMILES | C[C@@H](N)[C@H](NC(=O)c1ccc(C#CC#CC2CNC2)cc1)C(=O)NO |
| InChI | InChI=1S/C18H20N4O3/c1-12(19)16(18(24)22-25)21-17(23)15-8-6-13(7-9-15)4-2-3-5-14-10-20-11-14/h6-9,12,14,16,20,25H,10-11,19H2,1H3,(H,21,23)(H,22,24)/t12-,16+/m1/s1 |
| InChIKey | NEEKRPKHXDAYMZ-WBMJQRKESA-N |
| XLogP | -0.79 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|