C19H18F2N2O3 — CID 171510109
4-(4-cyclopropylbuta-1,3-diynyl)-N-[(2S,3R)-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 171510109) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-(4-cyclopropylbuta-1,3-diynyl)-N-[(2S,3R)-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-(4-cyclopropylbuta-1,3-diynyl)-N-[(2S,3R)-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 171510109 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-(4-cyclopropylbuta-1,3-diynyl)-N-[(2S,3R)-4,4-difluoro-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | C[C@@H](C(F)F)[C@H](NC(=O)c1ccc(C#CC#CC2CC2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H18F2N2O3/c1-12(17(20)21)16(19(25)23-26)22-18(24)15-10-8-14(9-11-15)5-3-2-4-13-6-7-13/h8-13,16-17,26H,6-7H2,1H3,(H,22,24)(H,23,25)/t12-,16+/m1/s1 |
| InChIKey | NBEDAZNALZGYMV-WBMJQRKESA-N |
| XLogP | 1.96 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|