C18H21F2N2O5P — CID 171510165
[[2-[[4-(2-cyclopropylethynyl)benzoyl]amino]-4,4-difluoro-3-methylbutanoyl]amino] methyl hydrogen phosphite (PubChem CID 171510165) has the molecular formula C18H21F2N2O5P and a molecular weight of 414.35 g/mol. Its IUPAC name is [[2-[[4-(2-cyclopropylethynyl)benzoyl]amino]-4,4-difluoro-3-methylbutanoyl]amino] methyl hydrogen phosphite.
| Compound Name | [[2-[[4-(2-cyclopropylethynyl)benzoyl]amino]-4,4-difluoro-3-methylbutanoyl]amino] methyl hydrogen phosphite |
|---|---|
| PubChem CID | 171510165 |
| Molecular Formula | C18H21F2N2O5P |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [[2-[[4-(2-cyclopropylethynyl)benzoyl]amino]-4,4-difluoro-3-methylbutanoyl]amino] methyl hydrogen phosphite |
| SMILES | COP(O)ONC(=O)C(NC(=O)c1ccc(C#CC2CC2)cc1)C(C)C(F)F |
| InChI | InChI=1S/C18H21F2N2O5P/c1-11(16(19)20)15(18(24)22-27-28(25)26-2)21-17(23)14-9-7-13(8-10-14)6-5-12-3-4-12/h7-12,15-16,25H,3-4H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | NAHYZJJYQGWRDL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|