C25H29N3O4 — CID 59417030
N-[1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(propanoylamino)phenyl]ethynyl]benzamide (PubChem CID 59417030) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(propanoylamino)phenyl]ethynyl]benzamide.
| Compound Name | N-[1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(propanoylamino)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59417030 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]-4-[2-[4-(propanoylamino)phenyl]ethynyl]benzamide |
| SMILES | CCONC(=O)C(NC(=O)c1ccc(C#Cc2ccc(NC(=O)CC)cc2)cc1)C(C)C |
| InChI | InChI=1S/C25H29N3O4/c1-5-22(29)26-21-15-11-19(12-16-21)8-7-18-9-13-20(14-10-18)24(30)27-23(17(3)4)25(31)28-32-6-2/h9-17,23H,5-6H2,1-4H3,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | NMGSEPOKSQVCMM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|