C24H28N4O5S — CID 87199372
4-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethynyl]-N-[(2R)-3-ethylsulfinyl-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide (PubChem CID 87199372) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethynyl]-N-[(2R)-3-ethylsulfinyl-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethynyl]-N-[(2R)-3-ethylsulfinyl-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 87199372 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-[2-[4-[[(2S)-2-aminopropanoyl]amino]phenyl]ethynyl]-N-[(2R)-3-ethylsulfinyl-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CCS(=O)C(C)[C@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)[C@H](C)N)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C24H28N4O5S/c1-4-34(33)16(3)21(24(31)28-32)27-23(30)19-11-7-17(8-12-19)5-6-18-9-13-20(14-10-18)26-22(29)15(2)25/h7-16,21,32H,4,25H2,1-3H3,(H,26,29)(H,27,30)(H,28,31)/t15-,16?,21-,34?/m0/s1 |
| InChIKey | JEUWZTRUWPUKPW-DMOWYTDISA-N |
| XLogP | 1.13 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|