C24H26BrN3O4 — CID 59697899
4-[2-[4-[(2-bromoacetyl)amino]phenyl]ethynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 59697899) has the molecular formula C24H26BrN3O4 and a molecular weight of 500.39 g/mol. Its IUPAC name is 4-[2-[4-[(2-bromoacetyl)amino]phenyl]ethynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[2-[4-[(2-bromoacetyl)amino]phenyl]ethynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697899 |
| Molecular Formula | C24H26BrN3O4 |
| Molecular Weight | 500.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 4-[2-[4-[(2-bromoacetyl)amino]phenyl]ethynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCONC(=O)[C@@H](NC(=O)c1ccc(C#Cc2ccc(NC(=O)CBr)cc2)cc1)C(C)C |
| InChI | InChI=1S/C24H26BrN3O4/c1-4-32-28-24(31)22(16(2)3)27-23(30)19-11-7-17(8-12-19)5-6-18-9-13-20(14-10-18)26-21(29)15-25/h7-14,16,22H,4,15H2,1-3H3,(H,26,29)(H,27,30)(H,28,31)/t22-/m0/s1 |
| InChIKey | QAFOHYLDCYYXPW-QFIPXVFZSA-N |
| XLogP | 3.24 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|