C23H22ClN3O3 — CID 59697721
4-[4-(6-chloro-3-pyridinyl)buta-1,3-diynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide (PubChem CID 59697721) has the molecular formula C23H22ClN3O3 and a molecular weight of 423.90 g/mol. Its IUPAC name is 4-[4-(6-chloro-3-pyridinyl)buta-1,3-diynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-[4-(6-chloro-3-pyridinyl)buta-1,3-diynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 59697721 |
| Molecular Formula | C23H22ClN3O3 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[4-(6-chloro-3-pyridinyl)buta-1,3-diynyl]-N-[(2S)-1-(ethoxyamino)-3-methyl-1-oxobutan-2-yl]benzamide |
| SMILES | CCONC(=O)[C@@H](NC(=O)c1ccc(C#CC#Cc2ccc(Cl)nc2)cc1)C(C)C |
| InChI | InChI=1S/C23H22ClN3O3/c1-4-30-27-23(29)21(16(2)3)26-22(28)19-12-9-17(10-13-19)7-5-6-8-18-11-14-20(24)25-15-18/h9-16,21H,4H2,1-3H3,(H,26,28)(H,27,29)/t21-/m0/s1 |
| InChIKey | OECNLHVERMCPON-NRFANRHFSA-N |
| XLogP | 2.96 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|