C18H22F2N3O2+ — CID 171510133
N-(1-amino-4,4-difluoro-3-methyl-1-oxobutan-2-yl)-4-[2-(1,1-dimethylaziridin-1-ium-2-yl)ethynyl]benzamide (PubChem CID 171510133) has the molecular formula C18H22F2N3O2+ and a molecular weight of 350.39 g/mol. Its IUPAC name is N-(1-amino-4,4-difluoro-3-methyl-1-oxobutan-2-yl)-4-[2-(1,1-dimethylaziridin-1-ium-2-yl)ethynyl]benzamide.
| Compound Name | N-(1-amino-4,4-difluoro-3-methyl-1-oxobutan-2-yl)-4-[2-(1,1-dimethylaziridin-1-ium-2-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 171510133 |
| Molecular Formula | C18H22F2N3O2+ |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-(1-amino-4,4-difluoro-3-methyl-1-oxobutan-2-yl)-4-[2-(1,1-dimethylaziridin-1-ium-2-yl)ethynyl]benzamide |
| SMILES | CC(C(F)F)C(NC(=O)c1ccc(C#CC2C[N+]2(C)C)cc1)C(N)=O |
| InChI | InChI=1S/C18H21F2N3O2/c1-11(16(19)20)15(17(21)24)22-18(25)13-7-4-12(5-8-13)6-9-14-10-23(14,2)3/h4-5,7-8,11,14-16H,10H2,1-3H3,(H2-,21,22,24,25)/p+1 |
| InChIKey | GTGGICXZNQPEFT-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|