C39H52Cl2N20O5 — CID 59418919
1,3-bis[4-[[2-chloro-9-[(1R,2S,3R,4S)-4-(5-ethyltetrazol-2-yl)-2,3-dihydroxycyclopentyl]purin-6-yl]amino]cyclohexyl]urea (PubChem CID 59418919) has the molecular formula C39H52Cl2N20O5 and a molecular weight of 951.89 g/mol. Its IUPAC name is 1,3-bis[4-[[2-chloro-9-[(1R,2S,3R,4S)-4-(5-ethyltetrazol-2-yl)-2,3-dihydroxycyclopentyl]purin-6-yl]amino]cyclohexyl]urea.
| Compound Name | 1,3-bis[4-[[2-chloro-9-[(1R,2S,3R,4S)-4-(5-ethyltetrazol-2-yl)-2,3-dihydroxycyclopentyl]purin-6-yl]amino]cyclohexyl]urea |
|---|---|
| PubChem CID | 59418919 |
| Molecular Formula | C39H52Cl2N20O5 |
| Molecular Weight | 951.89 g/mol |
| Exact Mass | 950.38 |
| IUPAC Name | 1,3-bis[4-[[2-chloro-9-[(1R,2S,3R,4S)-4-(5-ethyltetrazol-2-yl)-2,3-dihydroxycyclopentyl]purin-6-yl]amino]cyclohexyl]urea |
| SMILES | CCc1nnn([C@H]2C[C@@H](n3cnc4c(NC5CCC(NC(=O)NC6CCC(Nc7nc(Cl)nc8c7ncn8[C@@H]7C[C@H](n8nnc(CC)n8)[C@@H](O)[C@H]7O)CC6)CC5)nc(Cl)nc43)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C39H52Cl2N20O5/c1-3-25-52-56-60(54-25)23-13-21(29(62)31(23)64)58-15-42-27-33(48-37(40)50-35(27)58)44-17-5-9-19(10-6-17)46-39(66)47-20-11-7-18(8-12-20)45-34-28-36(51-38(41)49-34)59(16-43-28)22-14-24(32(65)30(22)63)61-55-26(4-2)53-57-61/h15-24,29-32,62-65H,3-14H2,1-2H3,(H,44,48,50)(H,45,49,51)(H2,46,47,66)/t17?,18?,19?,20?,21-,22-,23+,24+,29+,30+,31-,32-/m1/s1 |
| InChIKey | BHSLCWIRZDXNFE-LVKQTCKYSA-N |
| XLogP | 1.63 |
| TPSA | 320.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.89 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 23 |