C16H23NO3Y-2 — CID 59420351
carbanide;1-[(1R)-6-hydroxy-1-methanidyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-yl]butan-1-one;yttrium (PubChem CID 59420351) has the molecular formula C16H23NO3Y-2 and a molecular weight of 366.27 g/mol. Its IUPAC name is carbanide;1-[(1R)-6-hydroxy-1-methanidyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-yl]butan-1-one;yttrium.
| Compound Name | carbanide;1-[(1R)-6-hydroxy-1-methanidyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-yl]butan-1-one;yttrium |
|---|---|
| PubChem CID | 59420351 |
| Molecular Formula | C16H23NO3Y-2 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | carbanide;1-[(1R)-6-hydroxy-1-methanidyl-7-methoxy-3,4-dihydro-2H-isoquinolin-1-yl]butan-1-one;yttrium |
| SMILES | [CH2-][C@@]1(C(=O)CCC)NCCc2cc(O)c(OC)cc21.[CH3-].[Y] |
| InChI | InChI=1S/C15H20NO3.CH3.Y/c1-4-5-14(18)15(2)11-9-13(19-3)12(17)8-10(11)6-7-16-15;;/h8-9,16-17H,2,4-7H2,1,3H3;1H3;/q2*-1;/t15-;;/m1../s1 |
| InChIKey | FAEKQLPIPYTZPV-QCUBGVIVSA-N |
| XLogP | 2.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|