C24H25FN4OS — CID 59421277
4-(2-fluorophenyl)-N-phenyl-N-propan-2-yl-2-thiomorpholin-4-ylpyrimidine-5-carboxamide (PubChem CID 59421277) has the molecular formula C24H25FN4OS and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-N-phenyl-N-propan-2-yl-2-thiomorpholin-4-ylpyrimidine-5-carboxamide.
| Compound Name | 4-(2-fluorophenyl)-N-phenyl-N-propan-2-yl-2-thiomorpholin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59421277 |
| Molecular Formula | C24H25FN4OS |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-(2-fluorophenyl)-N-phenyl-N-propan-2-yl-2-thiomorpholin-4-ylpyrimidine-5-carboxamide |
| SMILES | CC(C)N(C(=O)c1cnc(N2CCSCC2)nc1-c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C24H25FN4OS/c1-17(2)29(18-8-4-3-5-9-18)23(30)20-16-26-24(28-12-14-31-15-13-28)27-22(20)19-10-6-7-11-21(19)25/h3-11,16-17H,12-15H2,1-2H3 |
| InChIKey | YIHNXRVATZIGJA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |