C22H29ClN6O4 — CID 59421739
ethyl N-[2-[[4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-(3-methylbut-2-enyl)imidazole-2-carbonyl]amino]ethyl]carbamate (PubChem CID 59421739) has the molecular formula C22H29ClN6O4 and a molecular weight of 476.97 g/mol. Its IUPAC name is ethyl N-[2-[[4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-(3-methylbut-2-enyl)imidazole-2-carbonyl]amino]ethyl]carbamate.
| Compound Name | ethyl N-[2-[[4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-(3-methylbut-2-enyl)imidazole-2-carbonyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 59421739 |
| Molecular Formula | C22H29ClN6O4 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl N-[2-[[4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-(3-methylbut-2-enyl)imidazole-2-carbonyl]amino]ethyl]carbamate |
| SMILES | CCOC(=O)NCCNC(=O)c1nc(NC(=O)Nc2ccc(Cl)cc2C)cn1CC=C(C)C |
| InChI | InChI=1S/C22H29ClN6O4/c1-5-33-22(32)25-10-9-24-20(30)19-27-18(13-29(19)11-8-14(2)3)28-21(31)26-17-7-6-16(23)12-15(17)4/h6-8,12-13H,5,9-11H2,1-4H3,(H,24,30)(H,25,32)(H2,26,28,31) |
| InChIKey | ONXBSMUZFHZUJO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|