C24H21BrClF3N4O5 — CID 59421785
2-(2-bromoacetyl)oxyethyl 4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-2-carboxylate (PubChem CID 59421785) has the molecular formula C24H21BrClF3N4O5 and a molecular weight of 617.81 g/mol. Its IUPAC name is 2-(2-bromoacetyl)oxyethyl 4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-2-carboxylate.
| Compound Name | 2-(2-bromoacetyl)oxyethyl 4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-2-carboxylate |
|---|---|
| PubChem CID | 59421785 |
| Molecular Formula | C24H21BrClF3N4O5 |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 616.03 |
| IUPAC Name | 2-(2-bromoacetyl)oxyethyl 4-[(4-chloro-2-methylphenyl)carbamoylamino]-1-[[4-(trifluoromethyl)phenyl]methyl]imidazole-2-carboxylate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Nc1cn(Cc2ccc(C(F)(F)F)cc2)c(C(=O)OCCOC(=O)CBr)n1 |
| InChI | InChI=1S/C24H21BrClF3N4O5/c1-14-10-17(26)6-7-18(14)30-23(36)32-19-13-33(12-15-2-4-16(5-3-15)24(27,28)29)21(31-19)22(35)38-9-8-37-20(34)11-25/h2-7,10,13H,8-9,11-12H2,1H3,(H2,30,32,36) |
| InChIKey | KJIQFKHQRUDJMF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|