C30H28F3N3O4 — CID 59425053
(2,2,2-trifluoro-1-phenylethyl) N-[4-[3-cyano-6-(2-methoxyethoxy)-1-propan-2-ylindol-2-yl]phenyl]carbamate (PubChem CID 59425053) has the molecular formula C30H28F3N3O4 and a molecular weight of 551.57 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-phenylethyl) N-[4-[3-cyano-6-(2-methoxyethoxy)-1-propan-2-ylindol-2-yl]phenyl]carbamate.
| Compound Name | (2,2,2-trifluoro-1-phenylethyl) N-[4-[3-cyano-6-(2-methoxyethoxy)-1-propan-2-ylindol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59425053 |
| Molecular Formula | C30H28F3N3O4 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | (2,2,2-trifluoro-1-phenylethyl) N-[4-[3-cyano-6-(2-methoxyethoxy)-1-propan-2-ylindol-2-yl]phenyl]carbamate |
| SMILES | COCCOc1ccc2c(C#N)c(-c3ccc(NC(=O)OC(c4ccccc4)C(F)(F)F)cc3)n(C(C)C)c2c1 |
| InChI | InChI=1S/C30H28F3N3O4/c1-19(2)36-26-17-23(39-16-15-38-3)13-14-24(26)25(18-34)27(36)20-9-11-22(12-10-20)35-29(37)40-28(30(31,32)33)21-7-5-4-6-8-21/h4-14,17,19,28H,15-16H2,1-3H3,(H,35,37) |
| InChIKey | RDMHJELNEAFTLQ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|