C29H31N3O4 — CID 59425430
[4-[3-cyano-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl] pyrrolidine-1-carboxylate (PubChem CID 59425430) has the molecular formula C29H31N3O4 and a molecular weight of 485.58 g/mol. Its IUPAC name is [4-[3-cyano-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [4-[3-cyano-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59425430 |
| Molecular Formula | C29H31N3O4 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | [4-[3-cyano-1-cyclobutyl-6-(oxan-4-yloxy)indol-2-yl]phenyl] pyrrolidine-1-carboxylate |
| SMILES | N#Cc1c(-c2ccc(OC(=O)N3CCCC3)cc2)n(C2CCC2)c2cc(OC3CCOCC3)ccc12 |
| InChI | InChI=1S/C29H31N3O4/c30-19-26-25-11-10-24(35-23-12-16-34-17-13-23)18-27(25)32(21-4-3-5-21)28(26)20-6-8-22(9-7-20)36-29(33)31-14-1-2-15-31/h6-11,18,21,23H,1-5,12-17H2 |
| InChIKey | GUKYIWCKWQHJBI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |