C28H26N4O3 — CID 59426242
1-cyclobutyl-6-(oxan-4-yloxy)-2-(4-pyrimidin-2-yloxyphenyl)indole-3-carbonitrile (PubChem CID 59426242) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is 1-cyclobutyl-6-(oxan-4-yloxy)-2-(4-pyrimidin-2-yloxyphenyl)indole-3-carbonitrile.
| Compound Name | 1-cyclobutyl-6-(oxan-4-yloxy)-2-(4-pyrimidin-2-yloxyphenyl)indole-3-carbonitrile |
|---|---|
| PubChem CID | 59426242 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 1-cyclobutyl-6-(oxan-4-yloxy)-2-(4-pyrimidin-2-yloxyphenyl)indole-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Oc3ncccn3)cc2)n(C2CCC2)c2cc(OC3CCOCC3)ccc12 |
| InChI | InChI=1S/C28H26N4O3/c29-18-25-24-10-9-23(34-22-11-15-33-16-12-22)17-26(24)32(20-3-1-4-20)27(25)19-5-7-21(8-6-19)35-28-30-13-2-14-31-28/h2,5-10,13-14,17,20,22H,1,3-4,11-12,15-16H2 |
| InChIKey | MJLMYQCLQSEOMQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 82.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |