C24H36O3 — CID 59429257
[(5S,10R,14S,17R,19S)-6-hydroxy-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate (PubChem CID 59429257) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is [(5S,10R,14S,17R,19S)-6-hydroxy-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate.
| Compound Name | [(5S,10R,14S,17R,19S)-6-hydroxy-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate |
|---|---|
| PubChem CID | 59429257 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | [(5S,10R,14S,17R,19S)-6-hydroxy-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3CC[C@]45C=CCC(O)[C@H]4CCC5C3CC[C@H]2C1 |
| InChI | InChI=1S/C24H36O3/c1-15(25)27-17-9-12-23(2)16(14-17)5-6-18-19(23)10-13-24-11-3-4-22(26)21(24)8-7-20(18)24/h3,11,16-22,26H,4-10,12-14H2,1-2H3/t16-,17+,18?,19?,20?,21+,22?,23-,24-/m0/s1 |
| InChIKey | BFBIHQKMCSAJIM-POAXBQRSSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|