C24H36O2 — CID 59429258
[(10R,14S,17R,19S)-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate (PubChem CID 59429258) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is [(10R,14S,17R,19S)-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate.
| Compound Name | [(10R,14S,17R,19S)-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate |
|---|---|
| PubChem CID | 59429258 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | [(10R,14S,17R,19S)-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicos-8-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3CC[C@]45C=CCCC4CCC5C3CC[C@H]2C1 |
| InChI | InChI=1S/C24H36O2/c1-16(25)26-19-10-13-23(2)18(15-19)6-8-20-21(23)11-14-24-12-4-3-5-17(24)7-9-22(20)24/h4,12,17-22H,3,5-11,13-15H2,1-2H3/t17?,18-,19+,20?,21?,22?,23-,24+/m0/s1 |
| InChIKey | QKUJKCNXXWDLIJ-BBUVERFTSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|