C25H37NO2 — CID 59429264
[(5R,10S,14S,17R,19S)-8-isocyano-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl] acetate (PubChem CID 59429264) has the molecular formula C25H37NO2 and a molecular weight of 383.58 g/mol. Its IUPAC name is [(5R,10S,14S,17R,19S)-8-isocyano-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl] acetate.
| Compound Name | [(5R,10S,14S,17R,19S)-8-isocyano-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl] acetate |
|---|---|
| PubChem CID | 59429264 |
| Molecular Formula | C25H37NO2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | [(5R,10S,14S,17R,19S)-8-isocyano-14-methyl-17-pentacyclo[11.8.0.02,10.05,10.014,19]henicosanyl] acetate |
| SMILES | [C-]#[N+]C1CC[C@H]2CCC3C4CC[C@H]5C[C@H](OC(C)=O)CC[C@]5(C)C4CC[C@@]32C1 |
| InChI | InChI=1S/C25H37NO2/c1-16(27)28-20-10-12-24(2)18(14-20)5-8-21-22(24)11-13-25-15-19(26-3)7-4-17(25)6-9-23(21)25/h17-23H,4-15H2,1-2H3/t17-,18-,19?,20+,21?,22?,23?,24-,25-/m0/s1 |
| InChIKey | NFYOFVLIBUAYGR-YBLNKTCOSA-N |
| XLogP | 6.03 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|