C21H25N3O — CID 59430286
4-(4-methoxyphenyl)-5-(3,4,5-triethylphenyl)-2H-triazole (PubChem CID 59430286) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-(3,4,5-triethylphenyl)-2H-triazole.
| Compound Name | 4-(4-methoxyphenyl)-5-(3,4,5-triethylphenyl)-2H-triazole |
|---|---|
| PubChem CID | 59430286 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-(3,4,5-triethylphenyl)-2H-triazole |
| SMILES | CCc1cc(-c2n[nH]nc2-c2ccc(OC)cc2)cc(CC)c1CC |
| InChI | InChI=1S/C21H25N3O/c1-5-14-12-17(13-15(6-2)19(14)7-3)21-20(22-24-23-21)16-8-10-18(25-4)11-9-16/h8-13H,5-7H2,1-4H3,(H,22,23,24) |
| InChIKey | IFHRSXUMYIHZJN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |