C28H27NO4 — CID 59430819
(2R)-2-[[3-[[2-methyl-3-(4-methylbenzoyl)indol-1-yl]methyl]phenyl]methoxy]propanoic acid (PubChem CID 59430819) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2R)-2-[[3-[[2-methyl-3-(4-methylbenzoyl)indol-1-yl]methyl]phenyl]methoxy]propanoic acid.
| Compound Name | (2R)-2-[[3-[[2-methyl-3-(4-methylbenzoyl)indol-1-yl]methyl]phenyl]methoxy]propanoic acid |
|---|---|
| PubChem CID | 59430819 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (2R)-2-[[3-[[2-methyl-3-(4-methylbenzoyl)indol-1-yl]methyl]phenyl]methoxy]propanoic acid |
| SMILES | Cc1ccc(C(=O)c2c(C)n(Cc3cccc(CO[C@H](C)C(=O)O)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H27NO4/c1-18-11-13-23(14-12-18)27(30)26-19(2)29(25-10-5-4-9-24(25)26)16-21-7-6-8-22(15-21)17-33-20(3)28(31)32/h4-15,20H,16-17H2,1-3H3,(H,31,32)/t20-/m1/s1 |
| InChIKey | QZDWGCCDMRZNAI-HXUWFJFHSA-N |
| XLogP | 5.53 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |