C21H16F3IrN3O-2 — CID 59431387
iridium;1-(3-methylindol-1-id-2-yl)ethanone;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole (PubChem CID 59431387) has the molecular formula C21H16F3IrN3O-2 and a molecular weight of 575.59 g/mol. Its IUPAC name is iridium;1-(3-methylindol-1-id-2-yl)ethanone;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole.
| Compound Name | iridium;1-(3-methylindol-1-id-2-yl)ethanone;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
|---|---|
| PubChem CID | 59431387 |
| Molecular Formula | C21H16F3IrN3O-2 |
| Molecular Weight | 575.59 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | iridium;1-(3-methylindol-1-id-2-yl)ethanone;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
| SMILES | CC(=O)c1[n-]c2ccccc2c1C.FC(F)(F)c1c[c-]c(-n2cccn2)cc1.[Ir] |
| InChI | InChI=1S/C11H11NO.C10H6F3N2.Ir/c1-7-9-5-3-4-6-10(9)12-11(7)8(2)13;11-10(12,13)8-2-4-9(5-3-8)15-7-1-6-14-15;/h3-6H,1-2H3,(H,12,13);1-4,6-7H;/q;-1;/p-1 |
| InChIKey | DPWJTQNBTUWPLH-UHFFFAOYSA-M |
| XLogP | 5.00 |
| TPSA | 48.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|