C19H27N3O10PY-3 — CID 59441415
trans-(1S,4R)-1-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-3,4,5-trimethylcyclohexane-1-carboxylate;yttrium (PubChem CID 59441415) has the molecular formula C19H27N3O10PY-3 and a molecular weight of 577.32 g/mol. Its IUPAC name is trans-(1S,4R)-1-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-3,4,5-trimethylcyclohexane-1-carboxylate;yttrium.
| Compound Name | trans-(1S,4R)-1-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-3,4,5-trimethylcyclohexane-1-carboxylate;yttrium |
|---|---|
| PubChem CID | 59441415 |
| Molecular Formula | C19H27N3O10PY-3 |
| Molecular Weight | 577.32 g/mol |
| Exact Mass | 577.05 |
| IUPAC Name | trans-(1S,4R)-1-[[(2R,3R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-3,4,5-trimethylcyclohexane-1-carboxylate;yttrium |
| SMILES | C[C-]1C[C@@](OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C(O)[C@H]2O)(C(=O)[O-])CC(C)[C@@H]1C.[Y] |
| InChI | InChI=1S/C19H29N3O10P.Y/c1-9-6-19(17(25)26,7-10(2)11(9)3)32-33(28,29)30-8-12-14(23)15(24)16(31-12)22-5-4-13(20)21-18(22)27;/h4-5,9,11-12,14-16,23-24H,6-8H2,1-3H3,(H,25,26)(H,28,29)(H2,20,21,27);/q-1;/p-2/t9?,11-,12+,14-,15?,16+,19+;/m0./s1 |
| InChIKey | ZSELZMILZIXPNI-ZYUNPVQQSA-L |
| XLogP | -1.91 |
| TPSA | 209.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.32 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|