C23H21F2N3O2 — CID 59442605
1-(4-fluorophenyl)-4-(5-fluoro-2-pyridinyl)-4-pyridin-2-yloxycyclohexane-1-carboxamide (PubChem CID 59442605) has the molecular formula C23H21F2N3O2 and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(5-fluoro-2-pyridinyl)-4-pyridin-2-yloxycyclohexane-1-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-4-(5-fluoro-2-pyridinyl)-4-pyridin-2-yloxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59442605 |
| Molecular Formula | C23H21F2N3O2 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(5-fluoro-2-pyridinyl)-4-pyridin-2-yloxycyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(c2ccc(F)cc2)CCC(Oc2ccccn2)(c2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C23H21F2N3O2/c24-17-6-4-16(5-7-17)22(21(26)29)10-12-23(13-11-22,19-9-8-18(25)15-28-19)30-20-3-1-2-14-27-20/h1-9,14-15H,10-13H2,(H2,26,29) |
| InChIKey | TZDSXZCLJQYOCV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |