C18H20BrN3O3S — CID 59442868
2-[2-(2-aminoethyl)-6-bromobenzimidazol-1-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 59442868) has the molecular formula C18H20BrN3O3S and a molecular weight of 438.35 g/mol. Its IUPAC name is 2-[2-(2-aminoethyl)-6-bromobenzimidazol-1-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(2-aminoethyl)-6-bromobenzimidazol-1-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 59442868 |
| Molecular Formula | C18H20BrN3O3S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 2-[2-(2-aminoethyl)-6-bromobenzimidazol-1-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCn2c(CCN)nc3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C18H20BrN3O3S/c1-13-2-5-15(6-3-13)26(23,24)25-11-10-22-17-12-14(19)4-7-16(17)21-18(22)8-9-20/h2-7,12H,8-11,20H2,1H3 |
| InChIKey | MYIJVCSMAYEAMH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|