C18H20BN3O3S — CID 89044712
CID 89044712 (PubChem CID 89044712) has the molecular formula C18H20BN3O3S and a molecular weight of 369.26 g/mol.
| Compound Name | CID 89044712 |
|---|---|
| PubChem CID | 89044712 |
| Molecular Formula | C18H20BN3O3S |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)nc(CCN)n2CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20BN3O3S/c1-13-2-5-15(6-3-13)26(23,24)25-11-10-22-17-7-4-14(19)12-16(17)21-18(22)8-9-20/h2-7,12H,8-11,20H2,1H3 |
| InChIKey | MSPALUISVZDKHT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|