C42H36N2O6S2 — CID 126664188
2-[3-[9-[2-(4-methylphenyl)sulfonyloxyethyl]carbazol-1-yl]carbazol-9-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 126664188) has the molecular formula C42H36N2O6S2 and a molecular weight of 728.89 g/mol. Its IUPAC name is 2-[3-[9-[2-(4-methylphenyl)sulfonyloxyethyl]carbazol-1-yl]carbazol-9-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3-[9-[2-(4-methylphenyl)sulfonyloxyethyl]carbazol-1-yl]carbazol-9-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126664188 |
| Molecular Formula | C42H36N2O6S2 |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 728.20 |
| IUPAC Name | 2-[3-[9-[2-(4-methylphenyl)sulfonyloxyethyl]carbazol-1-yl]carbazol-9-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCn2c3ccccc3c3cc(-c4cccc5c6ccccc6n(CCOS(=O)(=O)c6ccc(C)cc6)c45)ccc32)cc1 |
| InChI | InChI=1S/C42H36N2O6S2/c1-29-14-19-32(20-15-29)51(45,46)49-26-24-43-39-12-5-4-9-36(39)38-28-31(18-23-41(38)43)34-10-7-11-37-35-8-3-6-13-40(35)44(42(34)37)25-27-50-52(47,48)33-21-16-30(2)17-22-33/h3-23,28H,24-27H2,1-2H3 |
| InChIKey | PJYYREKZQJXUOU-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|