C35H35NO4S — CID 23470524
[9-[3-(3-methoxyphenyl)propyl]-8-phenyl-1,2,3,4-tetrahydrocarbazol-3-yl] 4-methylbenzenesulfonate (PubChem CID 23470524) has the molecular formula C35H35NO4S and a molecular weight of 565.74 g/mol. Its IUPAC name is [9-[3-(3-methoxyphenyl)propyl]-8-phenyl-1,2,3,4-tetrahydrocarbazol-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [9-[3-(3-methoxyphenyl)propyl]-8-phenyl-1,2,3,4-tetrahydrocarbazol-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23470524 |
| Molecular Formula | C35H35NO4S |
| Molecular Weight | 565.74 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | [9-[3-(3-methoxyphenyl)propyl]-8-phenyl-1,2,3,4-tetrahydrocarbazol-3-yl] 4-methylbenzenesulfonate |
| SMILES | COc1cccc(CCCn2c3c(c4cccc(-c5ccccc5)c42)CC(OS(=O)(=O)c2ccc(C)cc2)CC3)c1 |
| InChI | InChI=1S/C35H35NO4S/c1-25-16-19-30(20-17-25)41(37,38)40-29-18-21-34-33(24-29)32-15-7-14-31(27-11-4-3-5-12-27)35(32)36(34)22-8-10-26-9-6-13-28(23-26)39-2/h3-7,9,11-17,19-20,23,29H,8,10,18,21-22,24H2,1-2H3 |
| InChIKey | UTGRIRBWDUAJDR-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|