C6H12BNO5 — CID 59444252
(2S)-2-[[hydroxy(methyl)boranyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 59444252) has the molecular formula C6H12BNO5 and a molecular weight of 188.98 g/mol. Its IUPAC name is (2S)-2-[[hydroxy(methyl)boranyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[hydroxy(methyl)boranyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59444252 |
| Molecular Formula | C6H12BNO5 |
| Molecular Weight | 188.98 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2S)-2-[[hydroxy(methyl)boranyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NB(C)O)C(=O)O |
| InChI | InChI=1S/C6H12BNO5/c1-7(12)8-4(6(10)11)3-5(9)13-2/h4,8,12H,3H2,1-2H3,(H,10,11)/t4-/m0/s1 |
| InChIKey | RMVWYIJPWRQTKP-BYPYZUCNSA-N |
| XLogP | -1.30 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.98 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|