C4H11BN2O3 — CID 59902605
(2S)-3-amino-2-[[hydroxy(methyl)boranyl]amino]propanoic acid (PubChem CID 59902605) has the molecular formula C4H11BN2O3 and a molecular weight of 145.96 g/mol. Its IUPAC name is (2S)-3-amino-2-[[hydroxy(methyl)boranyl]amino]propanoic acid.
| Compound Name | (2S)-3-amino-2-[[hydroxy(methyl)boranyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59902605 |
| Molecular Formula | C4H11BN2O3 |
| Molecular Weight | 145.96 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (2S)-3-amino-2-[[hydroxy(methyl)boranyl]amino]propanoic acid |
| SMILES | CB(O)N[C@@H](CN)C(=O)O |
| InChI | InChI=1S/C4H11BN2O3/c1-5(10)7-3(2-6)4(8)9/h3,7,10H,2,6H2,1H3,(H,8,9)/t3-/m0/s1 |
| InChIKey | WBAQKQNEJHWCEU-VKHMYHEASA-N |
| XLogP | -1.90 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.96 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|