C17H28O5 — CID 59444803
methyl 7-[(1R,2S,3R,5S)-5-acetyloxy-2-formyl-3-methylcyclopentyl]heptanoate (PubChem CID 59444803) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3R,5S)-5-acetyloxy-2-formyl-3-methylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3R,5S)-5-acetyloxy-2-formyl-3-methylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59444803 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl 7-[(1R,2S,3R,5S)-5-acetyloxy-2-formyl-3-methylcyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](C=O)[C@H](C)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H28O5/c1-12-10-16(22-13(2)19)14(15(12)11-18)8-6-4-5-7-9-17(20)21-3/h11-12,14-16H,4-10H2,1-3H3/t12-,14-,15+,16+/m1/s1 |
| InChIKey | BIHGHBFMSWMBBC-OJLVUWQFSA-N |
| XLogP | 2.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|