About (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one
(3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one (PubChem CID 59445853) has the molecular formula C21H21NO5S
and a molecular weight of 399.47 g/mol. Its IUPAC name is (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one |
| PubChem CID | 59445853 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one |
| SMILES | COc1ccc(S(=O)(=O)N2C=C[C@H](c3ccccc3)[C@H](CC(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-15(23)14-20-19(16-6-4-3-5-7-16)12-13-22(21(20)24)28(25,26)18-10-8-17(27-2)9-11-18/h3-13,19-20H,14H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | ULEQMQBAFSVTLG-UXHICEINSA-N |
| XLogP | 3.12 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one?
The IUPAC name of (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one (CID 59445853) is (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one.
What is the SMILES notation for (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one?
The canonical SMILES for (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one is COc1ccc(S(=O)(=O)N2C=C[C@H](c3ccccc3)[C@H](CC(C)=O)C2=O)cc1.
What is the InChIKey of (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one?
The InChIKey is ULEQMQBAFSVTLG-UXHICEINSA-N. The full InChI is InChI=1S/C21H21NO5S/c1-15(23)14-20-19(16-6-4-3-5-7-16)12-13-22(21(20)24)28(25,26)18-10-8-17(27-2)9-11-18/h3-13,19-20H,14H2,1-2H3/t19-,20+/m1/s1.
What are the key properties of (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one?
(3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one has a molecular weight of 399.47 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-(4-methoxyphenyl)sulfonyl-3-(2-oxopropyl)-4-phenyl-3,4-dihydropyridin-2-one is sourced from PubChem (CID 59445853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).