C20H18ArNO5S- — CID 161267191
argon;(3S,4S)-4-(4-methoxyphenyl)-2-oxo-3-phenacyl-3,4-dihydropyridine-1-sulfinate (PubChem CID 161267191) has the molecular formula C20H18ArNO5S- and a molecular weight of 424.38 g/mol. Its IUPAC name is argon;(3S,4S)-4-(4-methoxyphenyl)-2-oxo-3-phenacyl-3,4-dihydropyridine-1-sulfinate.
| Compound Name | argon;(3S,4S)-4-(4-methoxyphenyl)-2-oxo-3-phenacyl-3,4-dihydropyridine-1-sulfinate |
|---|---|
| PubChem CID | 161267191 |
| Molecular Formula | C20H18ArNO5S- |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | argon;(3S,4S)-4-(4-methoxyphenyl)-2-oxo-3-phenacyl-3,4-dihydropyridine-1-sulfinate |
| SMILES | COc1ccc([C@H]2C=CN(S(=O)[O-])C(=O)[C@H]2CC(=O)c2ccccc2)cc1.[Ar] |
| InChI | InChI=1S/C20H19NO5S.Ar/c1-26-16-9-7-14(8-10-16)17-11-12-21(27(24)25)20(23)18(17)13-19(22)15-5-3-2-4-6-15;/h2-12,17-18H,13H2,1H3,(H,24,25);/p-1/t17-,18+;/m1./s1 |
| InChIKey | IDTWFSFVHSBERV-URBRKQAFSA-M |
| XLogP | 2.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|