C13H14NO3S- — CID 59445835
(3S,4S)-3-benzyl-4-methyl-2-oxo-3,4-dihydropyridine-1-sulfinate (PubChem CID 59445835) has the molecular formula C13H14NO3S- and a molecular weight of 264.33 g/mol. Its IUPAC name is (3S,4S)-3-benzyl-4-methyl-2-oxo-3,4-dihydropyridine-1-sulfinate.
| Compound Name | (3S,4S)-3-benzyl-4-methyl-2-oxo-3,4-dihydropyridine-1-sulfinate |
|---|---|
| PubChem CID | 59445835 |
| Molecular Formula | C13H14NO3S- |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | (3S,4S)-3-benzyl-4-methyl-2-oxo-3,4-dihydropyridine-1-sulfinate |
| SMILES | C[C@H]1C=CN(S(=O)[O-])C(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO3S/c1-10-7-8-14(18(16)17)13(15)12(10)9-11-5-3-2-4-6-11/h2-8,10,12H,9H2,1H3,(H,16,17)/p-1/t10-,12-/m0/s1 |
| InChIKey | IDWOZSMCJUIBOC-JQWIXIFHSA-M |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|