C16H17N3S — CID 59446749
3-[4-(1H-pyrazol-4-yl)phenyl]-3-thiophen-2-ylpropan-1-amine (PubChem CID 59446749) has the molecular formula C16H17N3S and a molecular weight of 283.40 g/mol. Its IUPAC name is 3-[4-(1H-pyrazol-4-yl)phenyl]-3-thiophen-2-ylpropan-1-amine.
| Compound Name | 3-[4-(1H-pyrazol-4-yl)phenyl]-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 59446749 |
| Molecular Formula | C16H17N3S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 3-[4-(1H-pyrazol-4-yl)phenyl]-3-thiophen-2-ylpropan-1-amine |
| SMILES | NCCC(c1ccc(-c2cn[nH]c2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H17N3S/c17-8-7-15(16-2-1-9-20-16)13-5-3-12(4-6-13)14-10-18-19-11-14/h1-6,9-11,15H,7-8,17H2,(H,18,19) |
| InChIKey | DWLWDPGHQFVLBR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |