C40H32N6O10 — CID 59449363
[5-(1-ethyl-5-methoxybenzimidazol-2-yl)-2-(1-ethyl-6-methoxybenzimidazol-2-yl)-4-(4-nitrobenzoyl)oxyphenyl] 4-nitrobenzoate (PubChem CID 59449363) has the molecular formula C40H32N6O10 and a molecular weight of 756.73 g/mol. Its IUPAC name is [5-(1-ethyl-5-methoxybenzimidazol-2-yl)-2-(1-ethyl-6-methoxybenzimidazol-2-yl)-4-(4-nitrobenzoyl)oxyphenyl] 4-nitrobenzoate.
| Compound Name | [5-(1-ethyl-5-methoxybenzimidazol-2-yl)-2-(1-ethyl-6-methoxybenzimidazol-2-yl)-4-(4-nitrobenzoyl)oxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 59449363 |
| Molecular Formula | C40H32N6O10 |
| Molecular Weight | 756.73 g/mol |
| Exact Mass | 756.22 |
| IUPAC Name | [5-(1-ethyl-5-methoxybenzimidazol-2-yl)-2-(1-ethyl-6-methoxybenzimidazol-2-yl)-4-(4-nitrobenzoyl)oxyphenyl] 4-nitrobenzoate |
| SMILES | CCn1c(-c2cc(OC(=O)c3ccc([N+](=O)[O-])cc3)c(-c3nc4ccc(OC)cc4n3CC)cc2OC(=O)c2ccc([N+](=O)[O-])cc2)nc2cc(OC)ccc21 |
| InChI | InChI=1S/C40H32N6O10/c1-5-43-33-18-16-27(53-3)19-32(33)42-38(43)30-22-35(55-39(47)23-7-11-25(12-8-23)45(49)50)29(37-41-31-17-15-28(54-4)20-34(31)44(37)6-2)21-36(30)56-40(48)24-9-13-26(14-10-24)46(51)52/h7-22H,5-6H2,1-4H3 |
| InChIKey | XSNLTUGTSLPSEI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 192.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.73 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|