C18H14F2N2O2S — CID 59450302
ethyl 3-(2,4-difluorophenyl)-10-methyl-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxylate (PubChem CID 59450302) has the molecular formula C18H14F2N2O2S and a molecular weight of 360.39 g/mol. Its IUPAC name is ethyl 3-(2,4-difluorophenyl)-10-methyl-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxylate.
| Compound Name | ethyl 3-(2,4-difluorophenyl)-10-methyl-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 59450302 |
| Molecular Formula | C18H14F2N2O2S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | ethyl 3-(2,4-difluorophenyl)-10-methyl-11-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-5-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2F)c2c1Cc1cc(C)sc1-2 |
| InChI | InChI=1S/C18H14F2N2O2S/c1-3-24-18(23)15-12-7-10-6-9(2)25-17(10)16(12)22(21-15)14-5-4-11(19)8-13(14)20/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | YFKFQDFFTNCXEV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |