C18H18ClNO2 — CID 59451855
1-[1-[4-(4-chlorophenyl)phenyl]ethyl]azetidine-3-carboxylic acid (PubChem CID 59451855) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is 1-[1-[4-(4-chlorophenyl)phenyl]ethyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[1-[4-(4-chlorophenyl)phenyl]ethyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 59451855 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[1-[4-(4-chlorophenyl)phenyl]ethyl]azetidine-3-carboxylic acid |
| SMILES | CC(c1ccc(-c2ccc(Cl)cc2)cc1)N1CC(C(=O)O)C1 |
| InChI | InChI=1S/C18H18ClNO2/c1-12(20-10-16(11-20)18(21)22)13-2-4-14(5-3-13)15-6-8-17(19)9-7-15/h2-9,12,16H,10-11H2,1H3,(H,21,22) |
| InChIKey | JEPOGRTXESXNJA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |