C13H17NO2 — CID 65071734
1-[1-(4-methylphenyl)ethyl]azetidine-3-carboxylic acid (PubChem CID 65071734) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)ethyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[1-(4-methylphenyl)ethyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65071734 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[1-(4-methylphenyl)ethyl]azetidine-3-carboxylic acid |
| SMILES | Cc1ccc(C(C)N2CC(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C13H17NO2/c1-9-3-5-11(6-4-9)10(2)14-7-12(8-14)13(15)16/h3-6,10,12H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | GMFHPPGIBLGTQX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |