C21H22FN7O2S — CID 59453540
2-[(2-fluoro-4-pyridinyl)amino]-5-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1,3-thiazole-4-carboxamide (PubChem CID 59453540) has the molecular formula C21H22FN7O2S and a molecular weight of 455.52 g/mol. Its IUPAC name is 2-[(2-fluoro-4-pyridinyl)amino]-5-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2-fluoro-4-pyridinyl)amino]-5-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 59453540 |
| Molecular Formula | C21H22FN7O2S |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 2-[(2-fluoro-4-pyridinyl)amino]-5-[[4-(4-methylpiperazin-1-yl)benzoyl]amino]-1,3-thiazole-4-carboxamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3sc(Nc4ccnc(F)c4)nc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C21H22FN7O2S/c1-28-8-10-29(11-9-28)15-4-2-13(3-5-15)19(31)27-20-17(18(23)30)26-21(32-20)25-14-6-7-24-16(22)12-14/h2-7,12H,8-11H2,1H3,(H2,23,30)(H,27,31)(H,24,25,26) |
| InChIKey | LDXKNABKQPGJAT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|