C12H9F2NO2S — CID 59455697
ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 59455697) has the molecular formula C12H9F2NO2S and a molecular weight of 269.27 g/mol. Its IUPAC name is ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 59455697 |
| Molecular Formula | C12H9F2NO2S |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | ethyl 2-(2,6-difluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(-c2c(F)cccc2F)n1 |
| InChI | InChI=1S/C12H9F2NO2S/c1-2-17-12(16)9-6-18-11(15-9)10-7(13)4-3-5-8(10)14/h3-6H,2H2,1H3 |
| InChIKey | DDPCNNSTYGJTTL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |