C12H13BN4O3 — CID 59456999
CID 59456999 (PubChem CID 59456999) has the molecular formula C12H13BN4O3 and a molecular weight of 272.07 g/mol.
| Compound Name | CID 59456999 |
|---|---|
| PubChem CID | 59456999 |
| Molecular Formula | C12H13BN4O3 |
| Molecular Weight | 272.07 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H]1CNc2ncccc2N(CC(C)=O)C1=O |
| InChI | InChI=1S/C12H13BN4O3/c1-7(18)6-17-9-3-2-4-14-10(9)15-5-8(11(17)19)16-12(13)20/h2-4,8H,5-6H2,1H3,(H,14,15)(H,16,20)/t8-/m0/s1 |
| InChIKey | HDSRKADHJXSGMM-QMMMGPOBSA-N |
| XLogP | -0.32 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.07 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|