C35H44N2O5 — CID 59457155
4-[[(3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)indole (PubChem CID 59457155) has the molecular formula C35H44N2O5 and a molecular weight of 572.75 g/mol. Its IUPAC name is 4-[[(3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)indole.
| Compound Name | 4-[[(3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)indole |
|---|---|
| PubChem CID | 59457155 |
| Molecular Formula | C35H44N2O5 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.33 |
| IUPAC Name | 4-[[(3R,4R)-4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]piperidin-3-yl]oxymethyl]-1-(3-methoxypropyl)indole |
| SMILES | COCCCn1ccc2c(CO[C@H]3CNCC[C@@H]3c3ccc(OCCCOCc4ccccc4OC)cc3)cccc21 |
| InChI | InChI=1S/C35H44N2O5/c1-38-21-6-19-37-20-17-31-28(9-5-10-33(31)37)26-42-35-24-36-18-16-32(35)27-12-14-30(15-13-27)41-23-7-22-40-25-29-8-3-4-11-34(29)39-2/h3-5,8-15,17,20,32,35-36H,6-7,16,18-19,21-26H2,1-2H3/t32-,35+/m1/s1 |
| InChIKey | UAVHDGYDMLINLG-LDNVYYCDSA-N |
| XLogP | 6.33 |
| TPSA | 63.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|