C20H27N7O2 — CID 59457494
2-methyl-N-[[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-1,3-oxazol-4-yl]methyl]tetrazol-5-amine (PubChem CID 59457494) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-methyl-N-[[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-1,3-oxazol-4-yl]methyl]tetrazol-5-amine.
| Compound Name | 2-methyl-N-[[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-1,3-oxazol-4-yl]methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 59457494 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 2-methyl-N-[[2-[4-[3-(2-methylpyrrolidin-1-yl)propoxy]phenyl]-1,3-oxazol-4-yl]methyl]tetrazol-5-amine |
| SMILES | CC1CCCN1CCCOc1ccc(-c2nc(CNc3nnn(C)n3)co2)cc1 |
| InChI | InChI=1S/C20H27N7O2/c1-15-5-3-10-27(15)11-4-12-28-18-8-6-16(7-9-18)19-22-17(14-29-19)13-21-20-23-25-26(2)24-20/h6-9,14-15H,3-5,10-13H2,1-2H3,(H,21,24) |
| InChIKey | DQRNZHILJYYHDA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|