C32H38N4O2S — CID 59458199
2,6-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]-4-pyridin-4-ylbenzamide (PubChem CID 59458199) has the molecular formula C32H38N4O2S and a molecular weight of 542.75 g/mol. Its IUPAC name is 2,6-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]-4-pyridin-4-ylbenzamide.
| Compound Name | 2,6-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]-4-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 59458199 |
| Molecular Formula | C32H38N4O2S |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 2,6-dimethyl-N-[3-[4-[(4R)-4-phenyl-2-sulfanylidene-1,3-oxazolidin-3-yl]piperidin-1-yl]butyl]-4-pyridin-4-ylbenzamide |
| SMILES | Cc1cc(-c2ccncc2)cc(C)c1C(=O)NCCC(C)N1CCC(N2C(=S)OC[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C32H38N4O2S/c1-22-19-27(25-10-14-33-15-11-25)20-23(2)30(22)31(37)34-16-9-24(3)35-17-12-28(13-18-35)36-29(21-38-32(36)39)26-7-5-4-6-8-26/h4-8,10-11,14-15,19-20,24,28-29H,9,12-13,16-18,21H2,1-3H3,(H,34,37)/t24?,29-/m0/s1 |
| InChIKey | KGHNZQRAGPQMEK-PEFOLFAWSA-N |
| XLogP | 5.70 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|