C25H33N5O3 — CID 68799960
3-[4-[(5R)-3-(2-aminophenyl)-2-oxo-5-phenylimidazolidin-1-yl]piperidin-1-yl]butylcarbamic acid (PubChem CID 68799960) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[4-[(5R)-3-(2-aminophenyl)-2-oxo-5-phenylimidazolidin-1-yl]piperidin-1-yl]butylcarbamic acid.
| Compound Name | 3-[4-[(5R)-3-(2-aminophenyl)-2-oxo-5-phenylimidazolidin-1-yl]piperidin-1-yl]butylcarbamic acid |
|---|---|
| PubChem CID | 68799960 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 3-[4-[(5R)-3-(2-aminophenyl)-2-oxo-5-phenylimidazolidin-1-yl]piperidin-1-yl]butylcarbamic acid |
| SMILES | CC(CCNC(=O)O)N1CCC(N2C(=O)N(c3ccccc3N)C[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C25H33N5O3/c1-18(11-14-27-24(31)32)28-15-12-20(13-16-28)30-23(19-7-3-2-4-8-19)17-29(25(30)33)22-10-6-5-9-21(22)26/h2-10,18,20,23,27H,11-17,26H2,1H3,(H,31,32)/t18?,23-/m0/s1 |
| InChIKey | DWUYCKVTWIMKML-IMMUGOHXSA-N |
| XLogP | 3.76 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|