C30H46Cl2O — CID 59458342
(2S,4aS,6aS,6bR,10S,12aR)-10-chloro-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbonyl chloride (PubChem CID 59458342) has the molecular formula C30H46Cl2O and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S,4aS,6aS,6bR,10S,12aR)-10-chloro-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbonyl chloride.
| Compound Name | (2S,4aS,6aS,6bR,10S,12aR)-10-chloro-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbonyl chloride |
|---|---|
| PubChem CID | 59458342 |
| Molecular Formula | C30H46Cl2O |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (2S,4aS,6aS,6bR,10S,12aR)-10-chloro-2,4a,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-2-carbonyl chloride |
| SMILES | CC1(C)C2CC[C@]3(C)C(CC=C4C5C[C@@](C)(C(=O)Cl)CC[C@]5(C)CC[C@]43C)[C@@]2(C)CC[C@@H]1Cl |
| InChI | InChI=1S/C30H46Cl2O/c1-25(2)21-10-13-30(7)22(28(21,5)12-11-23(25)31)9-8-19-20-18-27(4,24(32)33)15-14-26(20,3)16-17-29(19,30)6/h8,20-23H,9-18H2,1-7H3/t20?,21?,22?,23-,26+,27-,28-,29+,30+/m0/s1 |
| InChIKey | APNKBAAMPNNEPJ-PGQFMDDYSA-N |
| XLogP | 9.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|